101469-92-5
| Name | N-(tert-Butoxycarbonyl)-(S)-(+)-3-pyrrolidinol |
| CAS | 101469-92-5 |
| EINECS(EC#) | 600-216-0 |
| Molecular Formula | C9H17NO3 |
| MDL Number | MFCD01317839 |
| Molecular Weight | 187.24 |
| MOL File | 101469-92-5.mol |
Chemical Properties
| Appearance | white to light yellow crystal powde |
| Melting point | 60-64 °C (lit.) |
| alpha | 26 º (c=1%, MeOH) |
| Boiling point | 273.3±33.0 °C(Predicted) |
| density | 1.142±0.06 g/cm3(Predicted) |
| refractive index | 27 ° (C=1, MeOH) |
| storage temp. | Store at 0-5°C |
| solubility | soluble in Methanol |
| form | Crystalline Powder |
| pka | 14.74±0.20(Predicted) |
| color | White to pale yellow |
| Optical Rotation | [α]20/D +26°, c = 1% in methanol |
| BRN | 6271108 |
| InChI | InChI=1S/C9H17NO3/c1-9(2,3)13-8(12)10-5-4-7(11)6-10/h7,11H,4-6H2,1-3H3/t7-/m0/s1 |
| InChIKey | APCBTRDHCDOPNY-ZETCQYMHSA-N |
| SMILES | N1(C(OC(C)(C)C)=O)CC[C@H](O)C1 |
| CAS DataBase Reference | 101469-92-5(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) |   GHS05,GHS06 |
| Signal word | Danger |
| Hazard statements | H301-H315-H318-H335 |
| Precautionary statements | P280-P301+P310+P330-P302+P352-P305+P351+P338+P310 |
| Hazard Codes | T,Xi |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 2811 6.1/PG 3 |
| WGK Germany | 3 |
| F | 10 |
| HazardClass | 6.1 |
| PackingGroup | Ⅲ |
| HS Code | 29339900 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral Eye Dam. 1 Skin Irrit. 2 STOT SE 3 |
