
17564-64-6
| Name | N-(Chloromethyl)phthalimide |
| CAS | 17564-64-6 |
| EINECS(EC#) | 241-541-4 |
| Molecular Formula | C9H6ClNO2 |
| MDL Number | MFCD00005898 |
| Molecular Weight | 195.6 |
| MOL File | 17564-64-6.mol |
Chemical Properties
| Appearance | white crystalline powder |
| Melting point | 131-135 °C (lit.) |
| Boiling point | 305.2±25.0 °C(Predicted) |
| density | 1.3228 (rough estimate) |
| refractive index | 1.5790 (estimate) |
| storage temp. | 2-8°C |
| solubility | chloroform: soluble50mg/mL |
| form | powder to crystal |
| pka | -2.63±0.20(Predicted) |
| color | White to Almost white |
| Water Solubility | slightly soluble |
| BRN | 140942 |
| InChI | InChI=1S/C9H6ClNO2/c10-5-11-8(12)6-3-1-2-4-7(6)9(11)13/h1-4H,5H2 |
| InChIKey | JKGLRGGCGUQNEX-UHFFFAOYSA-N |
| SMILES | C1(=O)C2=C(C=CC=C2)C(=O)N1CCl |
| CAS DataBase Reference | 17564-64-6(CAS DataBase Reference) |
| NIST Chemistry Reference | N-(chloromethyl)phthalimide(17564-64-6) |
| EPA Substance Registry System | 17564-64-6(EPA Substance) |
Safety Data
| Symbol(GHS) | ![]() GHS06 |
| Signal word | Danger |
| Hazard statements | H301-H315-H317-H319-H335 |
| Precautionary statements | P280-P301+P310+P330-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 2811 6.1 / PGIII |
| WGK Germany | 3 |
| F | 9-21 |
| TSCA | Yes |
| HS Code | 29251995 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral Eye Irrit. 2 Skin Irrit. 2 Skin Sens. 1 STOT SE 3 |
