
21898-19-1
| Name | Clenbuterol hydrochloride |
| CAS | 21898-19-1 |
| EINECS(EC#) | 244-643-7 |
| Molecular Formula | C12H19Cl3N2O |
| MDL Number | MFCD00083280 |
| Molecular Weight | 313.65 |
| MOL File | 21898-19-1.mol |
Chemical Properties
| Appearance | Colourless Microcyrstalline Powder |
| Melting point | 174-175.5°C |
| Fp | 9℃ |
| storage temp. | 2-8°C |
| solubility | Soluble in water and in ethanol (96 per cent), slightly soluble in acetone. |
| form | neat |
| color | White to off-white |
| Usage | Substituted phenylethanolamine with 2 sympathomimetic activity. Bronchodilator |
| Merck | 14,2347 |
| InChI | 1S/C12H18Cl2N2O.ClH/c1-12(2,3)16-6-10(17)7-4-8(13)11(15)9(14)5-7;/h4-5,10,16-17H,6,15H2,1-3H3;1H |
| InChIKey | OPXKTCUYRHXSBK-UHFFFAOYSA-N |
| SMILES | Cl.CC(C)(C)NCC(O)c1cc(Cl)c(N)c(Cl)c1 |
| CAS DataBase Reference | 21898-19-1(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) | ![]() GHS08 |
| Signal word | Danger |
| Hazard statements | H351-H360FD |
| Precautionary statements | P201-P308+P313 |
| Hazard Codes | T |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 2811 6.1/PG 3 |
| WGK Germany | 3 |
| RTECS | DN3180000 |
| HazardClass | 6.1(b) |
| PackingGroup | III |
| HS Code | 29221990 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Carc. 2 Repr. 1B |
| Toxicity |

