25086-89-9
| Name | Poly(1-vinylpyrrolidone-co-vinyl acetate) |
| CAS | 25086-89-9 |
| EINECS(EC#) | 200-001-8 |
| Molecular Formula | C30H45N3O9X2 |
| MDL Number | MFCD00134018 |
| Molecular Weight | 591.69 |
| MOL File | 25086-89-9.mol |
Chemical Properties
| Appearance | white powder |
| density | 1.27 g/mL at 25 °C(lit.) |
| Tg | 108 |
| refractive index | 1.4300 to 1.4380 |
| Fp | 72 °F |
| solubility | Greater than 10% solubility in 1,4-butanediol, glycerol, butanol, chloroform, dichloromethane, ethanol (95%), glycerol, methanol, polyethylene glycol 400, propan-2-ol, propanol, propylene glycol, and water. Less than 1% solubility in cyclohexane, diethyl ether, liquid paraffin, and pentane. |
| form | powder |
| color | White |
| Stability: | Stable. Combustible, especially in powdered form. Incompatible with strong oxidising agents, strong reducing agents. |
| Major Application | pharmaceutical (small molecule) |
| Cosmetics Ingredients Functions | BINDING FILM FORMING HAIR FIXING |
| InChI | InChI=1S/C6H9NO.C4H6O2/c1-2-7-5-3-4-6(7)8;1-3-6-4(2)5/h2H,1,3-5H2;3H,1H2,2H3 |
| InChIKey | FYUWIEKAVLOHSE-UHFFFAOYSA-N |
| SMILES | C(N1CCCC1=O)=C.O(C=C)C(=O)C |
| LogP | 0.370 (est) |
| EPA Substance Registry System | Acetic acid ethenyl ester, polymer with 1-ethenyl-2-pyrrolidinone(25086-89-9) |
Safety Data
| Symbol(GHS) |   GHS02,GHS07 |
| Signal word | Danger |
| Hazard statements | H225-H319-H336 |
| Precautionary statements | P210-P261-P305+P351+P338 |
| Hazard Codes | Xi,F |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 1987 3/PG 2 |
| WGK Germany | 1 |
| RTECS | AH3539000 |
| TSCA | TSCA listed |
| HazardClass | 3 |
| PackingGroup | II |
| HS Code | 29349990 |
| Storage Class | 11 - Combustible Solids |
| Toxicity |