
59721-29-8
| Name | Camostat mesilate |
| CAS | 59721-29-8 |
| EINECS(EC#) | 694-565-6 |
| Molecular Formula | C21H26N4O8S |
| MDL Number | MFCD00941410 |
| Molecular Weight | 494.52 |
| MOL File | 59721-29-8.mol |
Chemical Properties
| Appearance | Crystalline Solid |
| Melting point | 150-1550C |
| RTECS | CY1571620 |
| storage temp. | 2-8°C |
| solubility | H2O: ≥24mg/mL |
| form | powder |
| color | white to tan |
| Water Solubility | Soluble in water (100 mM), DMSO (100 mM), and ethanol (<1 mg/ml). |
| Usage | Orally active, non-peptide proteolitic enzyme inhibitor with anti-trypsin and anti-plasmin activities, related structurally to gabexate. Protease inhibitor |
| Merck | 14,1728 |
| Stability: | Stable for 2 years? from date of purchase as supplied. Solutions in DMSO or distilled water may be stored at -20° for up to 1 month. |
| InChIKey | FSEKIHNIDBATFG-UHFFFAOYSA-N |
| SMILES | CS(O)(=O)=O.CN(C)C(=O)COC(=O)Cc1ccc(OC(=O)c2ccc(NC(N)=N)cc2)cc1 |
| CAS DataBase Reference | 59721-29-8(CAS DataBase Reference) |
Safety Data
| Hazard Codes | Xi,N |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 3077 9 / PGIII |
| WGK Germany | 3 |
| HazardClass | 9 |
| HS Code | 2934999090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Aquatic Acute 1 Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |