| Melting point |
130-135 °C (lit.) |
| Boiling point |
500.3±43.0 °C(Predicted) |
| alpha |
-46°(24℃, c=2, C2H5OH) |
| Density |
1.222±0.06 g/cm3(Predicted) |
| refractive index |
-46 ° (C=2, EtOH) |
| storage temp. |
Sealed in dry,Room Temperature |
| solubility |
very faint turbidity in Methanol |
| form |
powder to crystal |
| pka |
3.48±0.36(Predicted) |
| color |
White to Almost white |
| optical activity |
[α]24/D 46°, c = 2 in ethanol |
| BRN |
3210897 |
| InChI |
1S/C16H15NO3/c1-11(12-7-3-2-4-8-12)17-15(18)13-9-5-6-10-14(13)16(19)20/h2-11H,1H3,(H,17,18)(H,19,20)/t11-/m0/s1 |
| InChIKey |
VCFKXWGKKDZMPO-NSHDSACASA-N |
| SMILES |
C[C@H](NC(=O)c1ccccc1C(O)=O)c2ccccc2 |
| CAS DataBase Reference |
21752-36-3(CAS DataBase Reference) |
| UNSPSC Code |
12352002 |
| NACRES |
NA.22 |