3,3,3-Triphenylpropionic acid
- Product Name3,3,3-Triphenylpropionic acid
- CAS900-91-4
- CBNumberCB1361599
- MFC21H18O2
- MW302.37
- MDL NumberMFCD00002713
- MOL File900-91-4.mol
- MSDS FileSDS
Chemical Properties
| Melting point | 180-182 °C (lit.) |
| Boiling point | 433.6±14.0 °C(Predicted) |
| Density | 1.161±0.06 g/cm3(Predicted) |
| vapor density | 10.1 (vs air) |
| storage temp. | Sealed in dry,Room Temperature |
| pka | 4.25±0.10(Predicted) |
| form | powder to crystal |
| color | White to Orange to Green |
| BRN | 2057448 |
| InChI | InChI=1S/C21H18O2/c22-20(23)16-21(17-10-4-1-5-11-17,18-12-6-2-7-13-18)19-14-8-3-9-15-19/h1-15H,16H2,(H,22,23) |
| InChIKey | XMSJLUKCGWQAHO-UHFFFAOYSA-N |
| SMILES | C(CC(=O)O)(C1=CC=CC=C1)(C1C=CC=CC=1)C1C=CC=CC=1 |
| CAS DataBase Reference | 900-91-4(CAS DataBase Reference) |
| NIST Chemistry Reference | 3,3,3-Triphenylpropionic acid(900-91-4) |
| UNSPSC Code | 12352100 |
| NACRES | NA.22 |
Safety
| Symbol(GHS) |
|
|||||||||
| Signal word | Warning | |||||||||
| Hazard statements | H315-H319-H335 | |||||||||
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 | |||||||||
| Hazard Codes | Xi | |||||||||
| Risk Statements | 36/37/38 | |||||||||
| Safety Statements | 37/39-26-37 | |||||||||
| WGK Germany | 3 | |||||||||
| HazardClass | IRRITANT | |||||||||
| HS Code | 29163990 | |||||||||
| Storage Class | 11 - Combustible Solids | |||||||||
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 | |||||||||
| NFPA 704: |
|
