| Melting point |
213 °C |
| Boiling point |
399.1±42.0 °C(Predicted) |
| Density |
1.17±0.1 g/cm3(Predicted) |
| storage temp. |
Inert atmosphere,Room Temperature |
| solubility |
DMSO (Slightly), Ethyl Acetate (Slightly), Methanol (Slightly) |
| pka |
8.48±0.35(Predicted) |
| form |
Solid |
| color |
Light Yellow to Yellow |
| Water Solubility |
Soluble in dimethyl sulfoxide, methanol and ethyl acetate. Slightly soluble in water. |
| BRN |
1913597 |
| InChI |
InChI=1S/C14H12N2O2/c17-13-7-3-1-5-11(13)9-15-16-10-12-6-2-4-8-14(12)18/h1-10,17-18H |
| InChIKey |
STOVYWBRBMYHPC-UHFFFAOYSA-N |
| SMILES |
C(=NN=CC1=CC=CC=C1O)C1=CC=CC=C1O |
| CAS DataBase Reference |
959-36-4(CAS DataBase Reference) |
| EPA Substance Registry System |
Benzaldehyde, 2-hydroxy-, [(2-hydroxyphenyl)methylene]hydrazone (959-36-4) |
