Tris(trimethylsilyl) borate
- Product NameTris(trimethylsilyl) borate
- CAS4325-85-3
- CBNumberCB3733453
- MFC9H27BO3Si3
- MW278.38
- EINECS629-367-0
- MDL NumberMFCD00051588
- MOL File4325-85-3.mol
- MSDS FileSDS
Chemical Properties
| Melting point | -35°C |
| Boiling point | 186 °C (lit.) |
| Density | 0.831 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point | 109 °F |
| storage temp. | Inert atmosphere,2-8°C |
| form | Liquid |
| Specific Gravity | 0.828 |
| color | Clear colorless |
| Hydrolytic Sensitivity | 7: reacts slowly with moisture/water |
| Sensitive | Moisture Sensitive |
| BRN | 1772733 |
| InChI | InChI=1S/C9H27BO3Si3/c1-14(2,3)11-10(12-15(4,5)6)13-16(7,8)9/h1-9H3 |
| InChIKey | YZYKZHPNRDIPFA-UHFFFAOYSA-N |
| SMILES | [Si](C)(C)(C)OB(O[Si](C)(C)C)O[Si](C)(C)C |
| CAS DataBase Reference | 4325-85-3 |
| EPA Substance Registry System | Silanol, trimethyl-, triester with boric acid (H3BO3) (4325-85-3) |
| UNSPSC Code | 12352103 |
Safety
| Symbol(GHS) |
 
|
|||||||||
| Signal word | Warning | |||||||||
| Hazard statements | H226-H315-H319-H335 | |||||||||
| Precautionary statements | P210-P302+P352-P305+P351+P338 | |||||||||
| Hazard Codes | Xi | |||||||||
| Risk Statements | 10-36/37/38 | |||||||||
| Safety Statements | 26-36 | |||||||||
| RIDADR | UN 1993 3/PG 3 | |||||||||
| WGK Germany | 3 | |||||||||
| F | 10-21 | |||||||||
| TSCA | TSCA listed | |||||||||
| HazardClass | 3 | |||||||||
| PackingGroup | III | |||||||||
| HS Code | 29319090 | |||||||||
| Storage Class | 3 - Flammable liquids | |||||||||
| Hazard Classifications | Eye Irrit. 2 Flam. Liq. 3 Skin Irrit. 2 STOT SE 3 | |||||||||
| NFPA 704: |
|
