1,2,3,4-Tetrafluorobenzene
- Product Name1,2,3,4-Tetrafluorobenzene
- CAS551-62-2
- CBNumberCB4366777
- MFC6H2F4
- MW150.07
- EINECS208-997-6
- MDL NumberMFCD00000285
- MOL File551-62-2.mol
- MSDS FileSDS
Chemical Properties
| Melting point | -42 °C (lit.) |
| Boiling point | 95 °C (lit.) |
| Density | 1.4 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point | 69 °F |
| storage temp. | Sealed in dry,2-8°C |
| form | clear liquid |
| color | Colorless to Light yellow to Light orange |
| Specific Gravity | 1.400 |
| BRN | 1910024 |
| Stability | Stable. Highly flammable. Incompatible with strong oxidizing agents. |
| InChI | InChI=1S/C6H2F4/c7-3-1-2-4(8)6(10)5(3)9/h1-2H |
| InChIKey | SOZFIIXUNAKEJP-UHFFFAOYSA-N |
| SMILES | C1(F)=CC=C(F)C(F)=C1F |
| CAS DataBase Reference | 551-62-2(CAS DataBase Reference) |
| FDA UNII | 66365S2RFQ |
| NIST Chemistry Reference | Benzene, 1,2,3,4-tetrafluoro-(551-62-2) |
| UNSPSC Code | 12352100 |
Safety
| Symbol(GHS) |
 
|
|||||||||
| Signal word | Danger | |||||||||
| Hazard statements | H225-H315-H319-H335 | |||||||||
| Precautionary statements | P210-P302+P352-P305+P351+P338 | |||||||||
| Hazard Codes | F,Xi | |||||||||
| Risk Statements | 11-36/37/38 | |||||||||
| Safety Statements | 16-26-36/37/39-33-7/9 | |||||||||
| RIDADR | UN 1993 3/PG 2 | |||||||||
| WGK Germany | 3 | |||||||||
| Hazard Note | Flammable | |||||||||
| HazardClass | 3 | |||||||||
| PackingGroup | II | |||||||||
| HS Code | 29039990 | |||||||||
| Storage Class | 3 - Flammable liquids | |||||||||
| Hazard Classifications | Eye Irrit. 2 Flam. Liq. 2 Skin Irrit. 2 STOT SE 3 | |||||||||
| NFPA 704: |
|
