REVERSE T3
- Product NameREVERSE T3
- CAS5817-39-0
- CBNumberCB5221268
- MFC15H12I3NO4
- MW650.97
- EINECS621-265-4
- MDL NumberMFCD00036864
- MOL File5817-39-0.mol
- MSDS FileSDS
Chemical Properties
| Melting point | 234-238 °C(lit.) |
| Boiling point | 534.6±50.0 °C(Predicted) |
| Density | 2.387±0.06 g/cm3(Predicted) |
| Flash point | 9℃ |
| storage temp. | Keep in dark place,Sealed in dry,Store in freezer, under -20°C |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | powder |
| pka | 2.17±0.20(Predicted) |
| color | Pale Beige to Brown |
| Stability | Light Sensitive |
| Major Application | clinical testing clinical testing |
| InChI | InChI=1S/C15H12I3NO4/c16-9-3-7(4-12(19)15(21)22)1-2-13(9)23-8-5-10(17)14(20)11(18)6-8/h1-3,5-6,12,20H,4,19H2,(H,21,22)/t12-/m0/s1 |
| InChIKey | HZCBWYNLGPIQRK-LBPRGKRZSA-N |
| SMILES | C(O)(=O)[C@H](CC1=CC=C(OC2=CC(I)=C(O)C(I)=C2)C(I)=C1)N |
| NCI Dictionary of Cancer Terms | T-3; triiodothyronine |
| FDA UNII | 8NZ4Y08T96 |
| UNSPSC Code | 41116107 |
| NACRES | NA.26 |
Safety
| Symbol(GHS) |
|
|||||||||
| Signal word | Warning | |||||||||
| Hazard statements | H302+H312+H332 | |||||||||
| Precautionary statements | P261-P264-P280-P301+P312-P302+P352+P312-P304+P340+P312 | |||||||||
| Hazard Codes | Xn,T,F | |||||||||
| Risk Statements | 36/37/38-20/21/22-39/23/24/25-23/24/25-11 | |||||||||
| Safety Statements | 36-45-36/37-16 | |||||||||
| RIDADR | UN1230 - class 3 - PG 2 - Methanol, solution | |||||||||
| WGK Germany | 3 | |||||||||
| RTECS | AY6750000 | |||||||||
| F | 8 | |||||||||
| HS Code | 29379000 | |||||||||
| Storage Class | 3 - Flammable liquids | |||||||||
| Hazard Classifications | Acute Tox. 3 Dermal Acute Tox. 3 Inhalation Acute Tox. 3 Oral Aquatic Chronic 3 Flam. Liq. 2 STOT SE 1 | |||||||||
| NFPA 704: |
|
