| Melting point |
53-56 °C(lit.) |
| Boiling point |
265 °C(lit.) |
| Density |
0.887 |
| vapor pressure |
1 mm Hg ( 84.5 °C) |
| refractive index |
1.5080 |
| Flash point |
239 °F |
| storage temp. |
Store below +30°C. |
| solubility |
water: soluble0.033g/L at 25°C |
| pka |
11.56±0.18(Predicted) |
| form |
Crystalline Solid |
| color |
White to yellow |
| PH |
4.5 (H2O, 20℃)(saturated aqueous solution) |
| Water Solubility |
practically insoluble |
| BRN |
1910383 |
| Stability |
Stable. Combustible. Incompatible with acid chlorides, oxidizing agents, acid anhydrides, copper, copper alloys, bases, brass. |
| InChI |
1S/C14H22O/c1-13(2,3)10-7-8-12(15)11(9-10)14(4,5)6/h7-9,15H,1-6H3 |
| InChIKey |
ICKWICRCANNIBI-UHFFFAOYSA-N |
| SMILES |
CC(C)(C)c1ccc(O)c(c1)C(C)(C)C |
| LogP |
4.8 at 23℃ |
| CAS DataBase Reference |
96-76-4(CAS DataBase Reference) |
| NIST Chemistry Reference |
Phenol, 2,4-bis(1,1-dimethylethyl)-(96-76-4) |
| EPA Substance Registry System |
2,4-Di-tert-butylphenol (96-76-4) |
