| Boiling point |
244-245 °C(lit.) |
| Density |
0.978 g/mL at 25 °C(lit.) |
| refractive index |
n20/D 1.526(lit.) |
| Flash point |
225 °F |
| storage temp. |
Sealed in dry,Room Temperature |
| pka |
14.92±0.10(Predicted) |
| form |
clear liquid |
| Specific Gravity |
0.978 |
| color |
Colorless to Light yellow to Light orange |
| Odor |
at 100.00 %. floral balsamic rose green |
| Odor Type |
floral |
| Cosmetics Ingredients Functions |
PERFUMING |
| InChI |
InChI=1S/C9H12O/c1-8-2-4-9(5-3-8)6-7-10/h2-5,10H,6-7H2,1H3 |
| InChIKey |
DAVFJRVIVZOKKS-UHFFFAOYSA-N |
| SMILES |
C1(CCO)=CC=C(C)C=C1 |
| LogP |
2.032 (est) |
| CAS DataBase Reference |
699-02-5(CAS DataBase Reference) |
| EPA Substance Registry System |
Benzeneethanol, 4-methyl- (699-02-5) |
