| Melting point |
72-74 °C(lit.) |
| Boiling point |
360 °C(lit.) |
| Density |
1.06 |
| vapor pressure |
0.002Pa at 25℃ |
| refractive index |
1.6231 (estimate) |
| Flash point |
360°C |
| storage temp. |
Sealed in dry,Room Temperature |
| solubility |
very faint turbidity in Methanol |
| pka |
0.39±0.10(Predicted) |
| form |
Liquid |
| color |
White |
| Water Solubility |
NEGLEGIBLE |
| λmax |
303 nm |
| BRN |
157021 |
| Stability |
Stable. Incompatible with strong oxidizing agents. |
| InChI |
1S/C15H11NO/c1-3-7-12(8-4-1)14-11-16-15(17-14)13-9-5-2-6-10-13/h1-11H |
| InChIKey |
CNRNYORZJGVOSY-UHFFFAOYSA-N |
| SMILES |
c1ccc(cc1)-c2cnc(o2)-c3ccccc3 |
| LogP |
4.1 at 30℃ and pH5.6 |
| CAS DataBase Reference |
92-71-7(CAS DataBase Reference) |
| NIST Chemistry Reference |
Oxazole, 2,5-diphenyl-(92-71-7) |
| EPA Substance Registry System |
Oxazole, 2,5-diphenyl- (92-71-7) |
