| Melting point |
280 °C (dec.)(lit.) |
| Boiling point |
514.77°C (rough estimate) |
| Density |
0.79 g/mL at 20 °C |
| bulk density |
390kg/m3 |
| refractive index |
1.5300 (estimate) |
| Flash point |
12°C (53.6°F) |
| storage temp. |
room temp |
| solubility |
alcohol: passes test |
| pka |
4.46(at 25℃) |
| form |
crystalline |
| color |
orange to red-brown, powder |
| PH Range |
4.0 (colorless) - 6.6 (green) |
| Water Solubility |
Soluble in ethanol and methanol. Slightly dimethyl sulfoxide. Insoluble in water. |
| λmax |
509nm |
| BRN |
58009 |
| Stability |
Stable. Incompatible with strong oxidizing agents. |
| Major Application |
Electroluminescent devices, sol-gel silica films, integrated circuits, photoresists, lithographic
printing plates, recording material, LED devices, photoconductors, Solid-state dye laser, lithographic printing plates, inks, Fluorescent pH sensors, emissive probes, chemotherapeutic treatment of disease, phototherapeutic treatment of disease, photodynamic treatment of disease |
| InChI |
1S/C20H10Cl2O5/c21-13-5-11-17(7-15(13)23)26-18-8-16(24)14(22)6-12(18)20(11)10-4-2-1-3-9(10)19(25)27-20/h1-8,23-24H |
| InChIKey |
NZVMJBGGAQSNLI-UHFFFAOYSA-N |
| SMILES |
Oc1cc2Oc3cc(O)c(Cl)cc3C4(OC(=O)c5ccccc45)c2cc1Cl |
| CAS DataBase Reference |
76-54-0(CAS DataBase Reference) |
| EPA Substance Registry System |
Spiro[isobenzofuran-1(3H),9'-[9H]xanthen]-3-one, 2',7'-dichloro-3',6'-dihydroxy- (76-54-0) |
