| Melting point |
117-119 °C(lit.) |
| Boiling point |
337.07°C (rough estimate) |
| Density |
1.2068 |
| vapor pressure |
0.04Pa |
| refractive index |
1.6010 (estimate) |
| Flash point |
119℃ |
| storage temp. |
2-8°C, protect from light |
| solubility |
382mg/L in organic solvents at 20 ℃ |
| pka |
2.42±0.10(Predicted) |
| Colour Index |
37130 |
| Appearance |
Yellow to orange Solid |
| Water Solubility |
Slightly soluble. <0.01 g/100 mL at 19.5 ºC |
| BRN |
879620 |
| Henry's Law Constant |
7.6×102 mol/(m3Pa) at 25℃, HSDB (2015) |
| Stability |
Stable, but may be moisture sensitive. Incompatible with water, acids, strong oxidizing agents, acid chlorides, acid anhydrides, chloroformates, liquid anisidine. |
| InChI |
1S/C7H8N2O3/c1-12-7-3-2-5(9(10)11)4-6(7)8/h2-4H,8H2,1H3 |
| InChIKey |
NIPDVSLAMPAWTP-UHFFFAOYSA-N |
| SMILES |
COc1ccc(cc1N)[N+]([O-])=O |
| LogP |
1.16 at 23℃ |
| CAS DataBase Reference |
99-59-2(CAS DataBase Reference) |
| IARC |
3 (Vol. 27, Sup 7) 1987 |
| NIST Chemistry Reference |
Benzenamine, 2-methoxy-5-nitro-(99-59-2) |
| EPA Substance Registry System |
2-Methoxy-5-nitroaniline (99-59-2) |