| Melting point |
300 °C |
| Boiling point |
410.43°C (rough estimate) |
| Density |
1.3382 (rough estimate) |
| refractive index |
-42 ° (C=0.2, 1mol/L NaOH) |
| storage temp. |
Keep in dark place,Inert atmosphere,Room temperature |
| solubility |
NH4OH 1 M: 50 mg/mL, clear to very faintly turbid, yellow to brown |
| pka |
9+-.0.20(Predicted) |
| form |
powder |
| color |
White to Off-white |
| PH |
2.37；9.33 |
| optical activity |
Consistent with structure |
| Water Solubility |
Slightly soluble in water. |
| λmax |
255 (pH 1) |
| BRN |
39814 |
| Major Application |
pharmaceutical |
| Cosmetics Ingredients Functions |
HAIR CONDITIONING |
| InChIKey |
OROIAVZITJBGSM-OJFKHTATSA-N |
| SMILES |
[n]2(c3[nH]c(n[c](c3nc2)=O)N)[C@@H]1O[C@@H]([C@H](C1)O)CO |
| CAS DataBase Reference |
961-07-9(CAS DataBase Reference) |
| NIST Chemistry Reference |
Deoxyguanosine(961-07-9) |
| EPA Substance Registry System |
Guanosine, 2'-deoxy- (961-07-9) |
