| Melting point |
368-372°C |
| Boiling point |
725.2±60.0 °C(Predicted) |
| Density |
1.73±0.1 g/cm3(Predicted) |
| storage temp. |
Keep in dark place,Sealed in dry,2-8°C |
| solubility |
DMF: soluble |
| form |
Solid |
| pka |
3.3, 4.6, 6.4, 7.0(at 25℃) |
| color |
Yellow to orange |
| PH Range |
Weak green ' uorescence (6.0) to strong green ' uourescence (7.2) |
| λmax |
492nm |
| BRN |
57037 |
| Biological Applications |
Authenticating canned products; detecting/measuring citrate; as a substrate for measuring phospholipase activity; use in ophthalmology |
| Major Application |
Fluorescent probe, diagnosis of cancer, leukemia, colorectal cancer, polynucleotide, bacteria, pathogens, nucleic acid, hepatitis A virus, dengue virus, herpes simplex virus, gene, HIV type, cardiovascular risk factor |
| InChI |
1S/C21H12O7/c22-11-2-5-15-17(8-11)27-18-9-12(23)3-6-16(18)21(15)14-4-1-10(19(24)25)7-13(14)20(26)28-21/h1-9,22-23H,(H,24,25) |
| InChIKey |
NJYVEMPWNAYQQN-UHFFFAOYSA-N |
| SMILES |
OC(=O)c1ccc2c(c1)C(=O)OC23c4ccc(O)cc4Oc5cc(O)ccc35 |
| CAS DataBase Reference |
76823-03-5(CAS DataBase Reference) |
