| Melting point |
>300 °C(lit.) |
| Boiling point |
736.4±60.0 °C(Predicted) |
| Density |
1.73±0.1 g/cm3(Predicted) |
| storage temp. |
Sealed in dry,2-8°C |
| solubility |
DMSO: soluble |
| form |
Solid |
| pka |
3.3, 4.6, 6.4, 7.0(at 25℃) |
| color |
Yellow to orange |
| PH Range |
Weak green ' uorescence (6.0) to strong green ' uourescence (7.2) |
| λmax |
492nm |
| BRN |
54341 |
| Major Application |
Diagnosis of hematologic cancer, nongastric diseases, detection of genetically modified wheat, chromosomes, gene expression, nucleic acid, hepatitis A virus, avian influenza virus subtype H5 and H5N1, SARS virus, herpex simplex virus |
| Biological Applications |
Diagnosing bladder cancer; evaluating corneal endothelial barrier function; as a substrate for measuring protein kinase activity, methyltransferase activity, phospholipase activity, rhodanese activity,sulfotransferase activity;use in ophthalmology |
| InChI |
1S/C21H12O7/c22-11-2-5-14-17(8-11)27-18-9-12(23)3-6-15(18)21(14)16-7-10(19(24)25)1-4-13(16)20(26)28-21/h1-9,22-23H,(H,24,25) |
| InChIKey |
BZTDTCNHAFUJOG-UHFFFAOYSA-N |
| SMILES |
OC(=O)c1ccc2C(=O)OC3(c4ccc(O)cc4Oc5cc(O)ccc35)c2c1 |
| CAS DataBase Reference |
3301-79-9(CAS DataBase Reference) |
| EPA Substance Registry System |
Spiro[isobenzofuran-1(3H),9'-[9H]xanthene]-6-carboxylic acid, 3',6'-dihydroxy-3-oxo- (3301-79-9) |
