| Melting point |
80-82 °C(lit.) |
| alpha |
22 º (c=2 in 95% ethanol) |
| Boiling point |
461.5±45.0 °C(Predicted) |
| Density |
1.152±0.06 g/cm3(Predicted) |
| refractive index |
16.5 ° (C=1, MeOH) |
| storage temp. |
Keep in dark place,Sealed in dry,Room Temperature |
| solubility |
Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. |
| form |
powder to crystal |
| pka |
3.50±0.10(Predicted) |
| color |
White to Almost white |
| optical activity |
[α]20/D +16.5±1°, c = 1% in methanol |
| BRN |
3065591 |
| Major Application |
peptide synthesis |
| InChI |
InChI=1S/C16H23NO5/c1-11(21-10-12-8-6-5-7-9-12)13(14(18)19)17-15(20)22-16(2,3)4/h5-9,11,13H,10H2,1-4H3,(H,17,20)(H,18,19)/t11-,13+/m1/s1 |
| InChIKey |
CTXPLTPDOISPTE-YPMHNXCESA-N |
| SMILES |
C(O)(=O)[C@H]([C@H](OCC1=CC=CC=C1)C)NC(OC(C)(C)C)=O |
| CAS DataBase Reference |
15260-10-3(CAS DataBase Reference) |
| EPA Substance Registry System |
L-Threonine, N-[(1,1-dimethylethoxy)carbonyl]-O-(phenylmethyl)- (15260-10-3) |