| Melting point |
99-101 °C(lit.) |
| Density |
1.1338 (rough estimate) |
| refractive index |
1.5400 (estimate) |
| storage temp. |
Refrigerator |
| solubility |
DMSO (Slightly), Methanol (Slightly) |
| form |
Solid |
| color |
Hygroscopic crystals |
| PH |
pH(20g/l,25℃) : 5.0~6.0 |
| Water Solubility |
Freely soluble in water, alcohol, acetone, or chloroform |
| Merck |
13,3057 |
| Stability |
Stable. Incompatible with strong oxidizing agents. Protect from moisture. |
| Major Application |
forensics and toxicology pharmaceutical (small molecule) |
| InChI |
InChI=1S/C20H29N3O2.ClH/c1-4-7-14-25-19-15-17(16-10-8-9-11-18(16)22-19)20(24)21-12-13-23(5-2)6-3;/h8-11,15H,4-7,12-14H2,1-3H3,(H,21,24);1H |
| InChIKey |
IVHBBMHQKZBJEU-UHFFFAOYSA-N |
| SMILES |
C12C=CC=CC1=NC(OCCCC)=CC=2C(=O)NCCN(CC)CC.Cl |
| CAS DataBase Reference |
61-12-1(CAS DataBase Reference) |