| Melting point |
~264 °C (dec.) |
| Boiling point |
492.2±45.0 °C(Predicted) |
| Density |
1.259±0.06 g/cm3(Predicted) |
| refractive index |
41 ° (C=2, H2O) |
| storage temp. |
Keep in dark place,Inert atmosphere,Store in freezer, under -20°C |
| solubility |
DMSO (Slightly, Heated), Water (Slightly, Sonicated) |
| pka |
3.28±0.10(Predicted) |
| form |
powder to crystal |
| color |
White to Almost white |
| optical activity |
Consistent with structure |
| Water Solubility |
almost transparency |
| InChI |
1S/C11H14N2O3/c12-7-10(14)13-9(11(15)16)6-8-4-2-1-3-5-8/h1-5,9H,6-7,12H2,(H,13,14)(H,15,16)/t9-/m0/s1 |
| InChIKey |
JBCLFWXMTIKCCB-VIFPVBQESA-N |
| SMILES |
NCC(=O)N[C@@H](Cc1ccccc1)C(O)=O |
| CAS DataBase Reference |
3321-03-7(CAS DataBase Reference) |
