| Melting point |
200 °C (dec.)(lit.) |
| Boiling point |
363.32°C (rough estimate) |
| Density |
1.2514 (rough estimate) |
| bulk density |
500kg/m3 |
| vapor pressure |
0-0Pa at 20-25℃ |
| refractive index |
1.4600 (estimate) |
| storage temp. |
Keep in dark place,Inert atmosphere,Room temperature |
| solubility |
Soluble in 95% ethanol(1 mg/mL). |
| form |
Powder/Solid |
| Colour Index |
75290 |
| pka |
6.7(at 25℃) |
| color |
Yellow to Brown |
| PH Range |
Red (0.0) to yellow (1.0);Pale yellow (5.0) to violet (6.0) |
| optical activity |
77.5°(C=0.01g/mL, MEOH, 20°C, 589nm) |
| Water Solubility |
SOLUBLE IN HOT WATER |
| Sensitive |
Light Sensitive |
| λmax |
292nm, 445nm, 560nm |
| Merck |
14,4637 |
| BRN |
91399 |
| Stability |
Stable, but may discolour on exposure to light. Incompatible with strong oxidizing agents. |
| Major Application |
Plasma displays, textiles, hair dyes, identifying fresh and stale rice, diag-nosing cancer progression, detecting nosing cancer progression, cervical disease, central nervous system malfunctions, detecting genes, breast cancer, collagen in a tissue sample, apoptosis, demyelinating diseases, antigens, treatment of age-related macular degeneration, burns, prostate cancer, diabetesand obesity, viral diseases, neoplasms, peripheral neural and vascular ailments, skin disorders, biotechnological applications, reference standard materials for cytology, histology andimmunohistochemistry |
| InChI |
1S/C16H14O6/c17-10-2-1-8-13-9-4-12(19)11(18)3-7(9)5-16(13,21)6-22-15(8)14(10)20/h1-4,13,17-21H,5-6H2/t13-,16+/m0/s1 |
| InChIKey |
WZUVPPKBWHMQCE-UHFFFAOYSA-N |
| SMILES |
Oc1cc2C[C@@]3(O)COc4c(O)c(O)ccc4[C@H]3c2cc1O |
| LogP |
0.3 at 30℃ and pH6.9 |
| CAS DataBase Reference |
517-28-2 |
| EPA Substance Registry System |
Hematoxylin (517-28-2) |
