| Melting point |
-60°C |
| Boiling point |
158-159 °C15 mm Hg(lit.) |
| Density |
1.049 g/mL at 25 °C(lit.) |
| vapor pressure |
0.0004 hPa (20 °C) |
| refractive index |
n20/D 1.484(lit.) |
| Flash point |
>230 °F |
| storage temp. |
Store below +30°C. |
| solubility |
Miscible with esters, ketones, ethers, and aromatic and aliphatic hydrocarbons. |
| form |
Liquid |
| color |
Clear colorless to slightly yellow |
| explosive limit |
0.7-4.5%(V) |
| Water Solubility |
<0.1 g/100 mL at 25 ºC |
| Sensitive |
Moisture Sensitive |
| BRN |
2726467 |
| Exposure limits |
TLV-TWA 0.0454 mg/m3 (0.005 ppm)
(ACGIH and NIOSH); ceiling 0.181 mg/m3
(0.02 ppm)/10 min (NIOSH).
. |
| Stability |
Reacts with all substances containing active hydrogen, such as acids, amines, water, phenols, mercaptans, amides, urea. Probably moisture sensitive. |
| Cosmetics Ingredients Functions |
FILM FORMING |
| InChI |
1S/C12H18N2O2/c1-11(2)4-10(14-9-16)5-12(3,6-11)7-13-8-15/h10H,4-7H2,1-3H3 |
| InChIKey |
NIMLQBUJDJZYEJ-UHFFFAOYSA-N |
| SMILES |
N(=C=O)C1CC(CC(C1)(C)C)(CN=C=O)C |
| LogP |
4.75 at 25℃ |
| CAS DataBase Reference |
4098-71-9(CAS DataBase Reference) |
| EPA Substance Registry System |
Isophorone diisocyanate (4098-71-9) |