| Melting point |
211 °C (dec.) (lit.) |
| alpha |
42 º (c=2,water,2 hrs) |
| vapor pressure |
8Pa at 20℃ |
| refractive index |
+39.0 to +42.0 ° (C=1, H2O) |
| storage temp. |
-20°C |
| solubility |
Soluble in concentrated hydrochloric acid, sulfuric acid, phosphoric acid and formic acid. Insoluble in water, dilute acids, dilute alkalis, concentrated alkalis and organic solvents. |
| form |
saline suspension |
| Boiling point |
636.4±55.0 °C(Predicted) |
| Density |
1.54 g/cm3 |
| pka |
13.04±0.20(Predicted) |
| color |
white to off-white |
| biological source |
crab (red) |
| optical activity |
Alpha type +75 → +41 Beta type -22 → +41.3 |
| Water Solubility |
H2O: 50 mg/mL colorless to faint yellow solution, clear to very slightly hazy |
| Sensitive |
Hygroscopic |
| Merck |
14,4458 |
| BRN |
1727589 |
| Stability |
Stable. Incompatible with strong oxidizing agents. |
| Cosmetic Ingredient Review (CIR) |
N-Acetyl-D-Glucosamine (7512-17-6) |
| InChI |
1S/C8H15NO6/c1-3(11)9-5-7(13)6(12)4(2-10)15-8(5)14/h4-8,10,12-14H,2H2,1H3,(H,9,11)/t4-,5-,6-,7-,8/m1/s1 |
| InChIKey |
OVRNDRQMDRJTHS-ROGOILFBSA-N |
| SMILES |
CC(=O)N[C@H]1C(O)O[C@H](CO)[C@@H](O)[C@@H]1O |
| LogP |
-2.2 at 23.7℃ |
| CAS DataBase Reference |
7512-17-6(CAS DataBase Reference) |
| EPA Substance Registry System |
N-Acetylglucosamine (7512-17-6) |
