| Melting point |
232 °C |
| Boiling point |
335.8±37.0 °C(Predicted) |
| Density |
1.751±0.06 g/cm3(Predicted) |
| Flash point |
100 °C |
| storage temp. |
Keep in dark place,Sealed in dry,Room Temperature |
| solubility |
Chloroform (Slightly, Heated), DMSO (Slightly), Methanol (Slightly, Heated) |
| pka |
-2.04±0.10(Predicted) |
| color |
White to Light yellow to Light orange |
| Sensitive |
Air & Light Sensitive |
| BRN |
2806732 |
| Henry's Law Constant |
2.3×101 mol/(m3Pa) at 25℃, HSDB (2015) |
| Stability |
Hygroscopic |
| Major Application |
agriculture environmental |
| InChI |
1S/C6H2Cl5N/c7-1-2(8)4(10)6(12)5(11)3(1)9/h12H2 |
| InChIKey |
KHCZSJXTDDHLGJ-UHFFFAOYSA-N |
| SMILES |
Nc1c(Cl)c(Cl)c(Cl)c(Cl)c1Cl |
| CAS DataBase Reference |
527-20-8(CAS DataBase Reference) |
| NIST Chemistry Reference |
Pentachloroaniline(527-20-8) |
| EPA Substance Registry System |
Benzenamine, 2,3,4,5,6-pentachloro- (527-20-8) |