| Melting point |
140-145°C |
| Boiling point |
654.1±55.0 °C(Predicted) |
| Density |
1.321±0.06 g/cm3(Predicted) |
| storage temp. |
Sealed in dry,Room Temperature |
| solubility |
DMSO (Slightly), Methanol (Slightly, Heated and Sonicated) |
| pka |
2.06±0.70(Predicted) |
| color |
Pale Yellow to Light Yellow |
| PH |
6.78 at 20.4℃ and 10g/L |
| Major Application |
pharmaceutical (small molecule) |
| InChIKey |
AHHPZGUFLGCZCF-UHFFFAOYSA-N |
| SMILES |
C1(COCCN2C(=O)C3=C(C2=O)C=CC=C3)NC(C)=C(C(OC)=O)C(C2=CC=CC=C2Cl)C=1C(OCC)=O |
| LogP |
4.9 at 30℃ and pH6.79 |
| CAS DataBase Reference |
88150-62-3(CAS DataBase Reference) |
