| Melting point |
198-204°C |
| Boiling point |
371.31℃[at 101 325 Pa] |
| Density |
1.4235 (rough estimate) |
| vapor pressure |
0Pa at 25℃ |
| refractive index |
1.6390 (estimate) |
| storage temp. |
Keep in dark place,Sealed in dry,Room Temperature |
| solubility |
Practically insoluble in water, freely soluble in dimethylformamide, slightly soluble in acetone and in ethanol (96 per cent). |
| form |
Solid |
| pka |
3.40±0.36(Predicted) |
| color |
White to Light Yellow |
| biological source |
rabbit |
| Water Solubility |
400mg/L at 28℃ |
| Merck |
14,7377 |
| BRN |
359901 |
| Major Application |
pharmaceutical (small molecule) |
| InChI |
1S/C17H13N3O5S2/c21-15(13-3-1-2-4-14(13)16(22)23)19-11-5-7-12(8-6-11)27(24,25)20-17-18-9-10-26-17/h1-10H,(H,18,20)(H,19,21)(H,22,23) |
| InChIKey |
PBMSWVPMRUJMPE-UHFFFAOYSA-N |
| SMILES |
OC(=O)c1ccccc1C(=O)Nc2ccc(cc2)S(=O)(=O)Nc3nccs3 |
| LogP |
-2 at 28℃ |
| CAS DataBase Reference |
85-73-4(CAS DataBase Reference) |
| NIST Chemistry Reference |
Phthalylsulfathiazole(85-73-4) |
| EPA Substance Registry System |
Benzoic acid, 2-[[[4-[(2-thiazolylamino)sulfonyl]phenyl]amino]carbonyl]- (85-73-4) |
