| Melting point |
306°C(lit.) |
| Boiling point |
474.44°C (rough estimate) |
| Density |
1.3138 (rough estimate) |
| refractive index |
1.6300 (estimate) |
| storage temp. |
Amber Vial, -20°C Freezer |
| solubility |
Chloroform (Very Slightly), Tetrahydrofuran (Slightly, Heated) |
| Colour Index |
12075 |
| form |
Solid |
| pka |
13.45±0.50(Predicted) |
| color |
Orange to Dark Red |
| BRN |
964718 |
| Henry's Law Constant |
1.1×109 mol/(m3Pa) at 25℃, HSDB (2015) |
| Major Application |
cleaning products cosmetics food and beverages personal care |
| Cosmetics Ingredients Functions |
COLORANT |
| InChI |
1S/C16H10N4O5/c21-15-8-5-10-3-1-2-4-12(10)16(15)18-17-13-7-6-11(19(22)23)9-14(13)20(24)25/h1-9,21H/b18-17+ |
| InChIKey |
HBHZKFOUIUMKHV-ISLYRVAYSA-N |
| SMILES |
Oc1ccc2ccccc2c1\N=N\c3ccc(cc3[N+]([O-])=O)[N+]([O-])=O |
| LogP |
3.610 (est) |
| CAS DataBase Reference |
3468-63-1(CAS DataBase Reference) |
| EPA Substance Registry System |
C.I. Pigment Orange 5 (3468-63-1) |