| Melting point |
172°C |
| Density |
1.4542 (rough estimate) |
| vapor pressure |
<1.3 x 10-5 Pa (25 °C) |
| refractive index |
1.6000 (estimate) |
| storage temp. |
Sealed in dry,Room Temperature |
| solubility |
DMF: 30 mg/mL; DMSO: 30 mg/mL |
| form |
Solid |
| pka |
7.28 |
| color |
White to off-white |
| Water Solubility |
<0.1 g/100 mL at 20 ºC |
| Merck |
13,9427 |
| BRN |
937942 |
| Henry's Law Constant |
8.2×103 mol/(m3Pa) at 25℃, HSDB (2015) |
| Stability |
Stable. Incompatible with strong oxidizing agents, alkalies, copper salts. |
| Major Application |
agriculture cleaning products cosmetics environmental food and beverages personal care |
| InChI |
1S/C12H14N4O4S2/c1-19-11(17)15-9(21)13-7-5-3-4-6-8(7)14-10(22)16-12(18)20-2/h3-6H,1-2H3,(H2,13,15,17,21)(H2,14,16,18,22) |
| InChIKey |
QGHREAKMXXNCOA-UHFFFAOYSA-N |
| SMILES |
COC(=O)NC(=S)Nc1ccccc1NC(=S)NC(=O)OC |
| LogP |
1.4 at 25℃ |
| EPA Substance Registry System |
Thiophanate-methyl (23564-05-8) |