| Melting point |
146-149 °C(lit.) |
| Density |
1.3799 (rough estimate) |
| refractive index |
1.5060 (estimate) |
| storage temp. |
Inert atmosphere,Store in freezer, under -20°C |
| solubility |
H2O: 50 mg/mL, clear, colorless |
| form |
Fine Powder |
| color |
White to off-white |
| Merck |
14,9621 |
| BRN |
3775022 |
| Major Application |
forensics and toxicology pharmaceutical (small molecule) |
| InChI |
InChI=1S/C9H11NO2.CH4O3S/c1-2-12-9(11)7-4-3-5-8(10)6-7;1-5(2,3)4/h3-6H,2,10H2,1H3;1H3,(H,2,3,4) |
| InChIKey |
FQZJYWMRQDKBQN-UHFFFAOYSA-N |
| SMILES |
C1(C=CC=C(N)C=1)C(=O)OCC.S(=O)(=O)(O)C |
| CAS DataBase Reference |
886-86-2(CAS DataBase Reference) |
| EPA Substance Registry System |
Benzoic acid, 3-amino-, ethyl ester, methanesulfonate (886-86-2) |