| Melting point |
70.0 to 74.0 °C |
| Boiling point |
314 ºC |
| Density |
1.20 |
| Flash point |
128 ºC |
| storage temp. |
Sealed in dry,Room Temperature |
| solubility |
soluble in Methanol |
| form |
powder to crystal |
| pka |
14.48±0.40(Predicted) |
| color |
White to Almost white |
| InChI |
InChI=1S/C13H18O3/c1-2-11(14)16-13-6-9-3-10(7-13)5-12(15,4-9)8-13/h2,9-10,15H,1,3-8H2 |
| InChIKey |
DKDKCSYKDZNMMA-UHFFFAOYSA-N |
| SMILES |
C(OC12CC3CC(CC(O)(C3)C1)C2)(=O)C=C |
| CAS DataBase Reference |
216581-76-9(CAS DataBase Reference) |
| EPA Substance Registry System |
2-Propenoic acid, 3-hydroxytricyclo[3.3.1.13,7]dec-1-yl ester (216581-76-9) |
