3-Dimethylaminoanisole
- Product Name3-Dimethylaminoanisole
- CAS15799-79-8
- MFC9H13NO
- MW151.21
- EINECS
- MOL File15799-79-8.mol
Chemical Properties
| Boiling point | 113-114 °C (6 mmHg) |
| Density | 1.031 |
| refractive index | 1.5575-1.5595 |
| Flash point | 113-114°C/6mm |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| form | clear liquid |
| pka | 4+-.0.10(Predicted) |
| color | White to Yellow to Green |
| Specific Gravity | 1.03 |
| Water Solubility | Not miscible or difficult to mix in water. |
| BRN | 1423591 |
| InChI | InChI=1S/C9H13NO/c1-10(2)8-5-4-6-9(7-8)11-3/h4-7H,1-3H3 |
| InChIKey | MOYHVSKDHLMMPS-UHFFFAOYSA-N |
| SMILES | C1(N(C)C)=CC=CC(OC)=C1 |
| CAS DataBase Reference | 15799-79-8(CAS DataBase Reference) |
| NIST Chemistry Reference | 3-Methoxy-N,N-dimethylbenzenamine(15799-79-8) |
Safety Information
| Hazard Codes | Xn |
| Risk Statements | 20/21/22 |
| Safety Statements | 36/37/39-26-23 |
| RIDADR | 2810 |
| WGK Germany | WGK 3 |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 2922290090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Skin Sens. 1 |
