| Melting point |
186-189 °C(lit.) |
| Boiling point |
530.2±50.0 °C(Predicted) |
| Density |
1.30±0.1 g/cm3(Predicted) |
| refractive index |
2 ° (C=5, CHCl3) |
| storage temp. |
Sealed in dry,2-8°C |
| solubility |
Chloroform (Slightly, Heated, Sonicated), Methanol (Slightly, Heated, Sonicated) |
| pka |
13.41±0.70(Predicted) |
| form |
Solid |
| color |
White to Light Brown |
| optical activity |
[α]24/D +1.7 to +3.0°, c = 10 in chloroform |
| BRN |
98835 |
| InChI |
1S/C16H23NO10/c1-7(18)17-13-15(25-10(4)21)14(24-9(3)20)12(6-23-8(2)19)27-16(13)26-11(5)22/h12-16H,6H2,1-5H3,(H,17,18)/t12-,13-,14-,15-,16-/m1/s1 |
| InChIKey |
OVPIZHVSWNOZMN-OXGONZEZSA-N |
| SMILES |
CC(=O)N[C@H]1[C@@H](O[C@H](COC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O)OC(C)=O |
| CAS DataBase Reference |
7772-79-4(CAS DataBase Reference) |