2-Oxo-4-phenylbutyric acid
- Product Name2-Oxo-4-phenylbutyric acid
- CAS710-11-2
- MFC10H10O3
- MW178.18
- EINECS211-916-7
- MOL File710-11-2.mol
Chemical Properties
| Melting point | 47.0 to 51.0 °C |
| Boiling point | 314.4±21.0 °C(Predicted) |
| Density | 1.212±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,2-8°C |
| form | powder to crystal |
| pka | 2.53±0.54(Predicted) |
| color | White to Light yellow |
| InChI | InChI=1S/C10H10O3/c11-9(10(12)13)7-6-8-4-2-1-3-5-8/h1-5H,6-7H2,(H,12,13) |
| InChIKey | PPKAIMDMNWBOKN-UHFFFAOYSA-N |
| SMILES | C1(=CC=CC=C1)CCC(=O)C(=O)O |
| CAS DataBase Reference | 710-11-2(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 41 |
| Safety Statements | 26-39 |
| HazardClass | IRRITANT |
| HS Code | 2915601990 |
