2-Pyridylamid oxime
- Product Name2-Pyridylamid oxime
- CAS1772-01-6
- MFC6H7N3O
- MW137.14
- EINECS
- MOL File1772-01-6.mol
Chemical Properties
| Melting point | 120-124 °C (lit.) |
| Boiling point | 278℃ |
| Density | 1.31 |
| refractive index | 1.6910 (estimate) |
| Flash point | 122℃ |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | DMF: 30 mg/ml; DMSO: 30 mg/ml; Ethanol: 20 mg/ml; PBS (pH 7.2): 1 mg/ml |
| form | powder to crystal |
| pka | 13.61±0.50(Predicted) |
| color | White to Light yellow |
| λmax | 277nm(H2O)(lit.) |
| InChI | InChI=1S/C6H7N3O/c7-6(9-10)5-3-1-2-4-8-5/h1-4,10H,(H2,7,9) |
| InChIKey | XKXCGXSHUNVFCT-UHFFFAOYSA-N |
| SMILES | C1(C(NO)=N)=NC=CC=C1 |
| CAS DataBase Reference | 1772-01-6 |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| RTECS | TJ4310000 |
| HazardClass | IRRITANT |
| HS Code | 29333990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |