N-Trans-Feruloyltyramine
- Product NameN-Trans-Feruloyltyramine
- CAS66648-43-9
- MFC18H19NO4
- MW313.35
- EINECS
- MOL File66648-43-9.mol
Chemical Properties
| Melting point | 138-140 °C(Solv: chloroform (67-66-3); methanol (67-56-1)) |
| Boiling point | 603.3±55.0 °C(Predicted) |
| Density | 1.248±0.06 g/cm3(Predicted) |
| storage temp. | -20°C |
| solubility | Soluble in DMSO and methan |
| form | powder |
| pka | 9.83±0.31(Predicted) |
| color | White |
| Major Application | metabolomics vitamins, nutraceuticals, and natural products |
| InChI | InChI=1S/C18H19NO4/c1-23-17-12-14(4-8-16(17)21)5-9-18(22)19-11-10-13-2-6-15(20)7-3-13/h2-9,12,20-21H,10-11H2,1H3,(H,19,22)/b9-5+ |
| InChIKey | NPNNKDMSXVRADT-WEVVVXLNSA-N |
| SMILES | C(NCCC1=CC=C(O)C=C1)(=O)/C=C/C1=CC=C(O)C(OC)=C1 |
Safety Information
| Hazard Codes | N |
| Risk Statements | 50 |
| Safety Statements | 61 |
| RIDADR | UN 3077 9 / PGIII |
| WGK Germany | 3 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Aquatic Acute 1 Aquatic Chronic 1 |
