Ethyl isobutyrylacetate
- Product NameEthyl isobutyrylacetate
- CAS7152-15-0
- MFC8H14O3
- MW158.2
- EINECS230-491-9
- MOL File7152-15-0.mol
Chemical Properties
| Melting point | -9 °C (lit.) |
| Boiling point | 173 °C (lit.) |
| Density | 0.98 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point | 128 °F |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | Soluble in chloroform and methanol. |
| form | Liquid |
| pka | 10.61±0.46(Predicted) |
| color | Clear colorless to light yellow |
| BRN | 636726 |
| InChI | InChI=1S/C8H14O3/c1-4-11-8(10)5-7(9)6(2)3/h6H,4-5H2,1-3H3 |
| InChIKey | XCLDSQRVMMXWMS-UHFFFAOYSA-N |
| SMILES | C(OCC)(=O)CC(=O)C(C)C |
| CAS DataBase Reference | 7152-15-0(CAS DataBase Reference) |
| NIST Chemistry Reference | Pentanoic acid, 4-methyl-3-oxo-, ethyl ester(7152-15-0) |
Safety Information
| Risk Statements | 10 |
| Safety Statements | 16 |
| RIDADR | UN 3272 3/PG 3 |
| WGK Germany | 3 |
| HazardClass | 3 |
| PackingGroup | III |
| HS Code | 29183000 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Flam. Liq. 3 |
