1-(3-Chlorophenyl)-4-(3-chloropropyl)piperazine hydrochloride
- Product Name1-(3-Chlorophenyl)-4-(3-chloropropyl)piperazine hydrochloride
- CAS52605-52-4
- MFC13H19Cl3N2
- MW309.66
- EINECS258-038-0
- MOL File52605-52-4.mol
Chemical Properties
| Melting point | 198-203 °C(lit.) |
| Boiling point | 147℃[at 101 325 Pa] |
| vapor pressure | 0Pa at 25℃ |
| storage temp. | 2-8°C |
| solubility | DMSO (Slightly, Heated), Methanol (Slightly, Heated) |
| form | powder to crystal |
| color | White to Light yellow |
| Water Solubility | 3.9g/L at 28℃ |
| InChI | InChI=1S/C13H18Cl2N2.ClH/c14-5-2-6-16-7-9-17(10-8-16)13-4-1-3-12(15)11-13;/h1,3-4,11H,2,5-10H2;1H |
| InChIKey | JVLRNANYLVRULL-UHFFFAOYSA-N |
| SMILES | ClC1=CC=CC(N2CCN(CCCCl)CC2)=C1.Cl |
| LogP | 0.301 at 28℃ |
| CAS DataBase Reference | 52605-52-4(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-20/21/22 |
| Safety Statements | 26-37/39-24/25 |
| WGK Germany | 3 |
| F | 10-21 |
| HS Code | 2933599550 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
