2-Mercapto-5-methyl-1,3,4-thiadiazole
- Product Name2-Mercapto-5-methyl-1,3,4-thiadiazole
- CAS29490-19-5
- MFC3H4N2S2
- MW132.21
- EINECS249-667-1
- MOL File29490-19-5.mol
Chemical Properties
| Melting point | 185-188 °C |
| Boiling point | 182.9±23.0 °C(Predicted) |
| Density | 1.373 (estimate) |
| refractive index | 1.5500 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | chloroform: soluble10mg/mL, clear to very slightly hazy, colorless |
| pka | 6.49±0.40(Predicted) |
| form | solid |
| color | White to Off-White |
| Water Solubility | 2 g/100 mL |
| BRN | 606663 |
| InChI | InChI=1S/C3H4N2S2/c1-2-4-5-3(6)7-2/h1H3,(H,5,6) |
| InChIKey | FPVUWZFFEGYCGB-UHFFFAOYSA-N |
| SMILES | S1C(C)=NNC1=S |
| CAS DataBase Reference | 29490-19-5(CAS DataBase Reference) |
| NIST Chemistry Reference | 1,3,4-Thiadiazole-2(3H)-thione, 5-methyl-(29490-19-5) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 37/39-26 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HS Code | 29349990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
