Methohexital
- Product NameMethohexital
- CAS151-83-7
- MFC14H18N2O3
- MW262.3
- EINECS205-798-6
- MOL File151-83-7.mol
Chemical Properties
| Melting point | 96 °C(Solv: ethanol (64-17-5)) |
| Density | 1.113 |
| storage temp. | 2-8°C |
| solubility | Acetonitrile (Slightly), Chloroform (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 7.82±0.10(Predicted) |
| color | White to Off-White |
| Major Application | pharmaceutical (small molecule) |
| InChI | 1S/C14H18N2O3/c1-5-7-8-10(3)14(9-6-2)11(17)15-13(19)16(4)12(14)18/h6,10H,2,5,9H2,1,3-4H3,(H,15,17,19) |
| InChIKey | NZXKDOXHBHYTKP-UHFFFAOYSA-N |
| SMILES | N1(C(=O)NC(=O)C(C1=O)(C(C)C#CCC)CC=C)C |
| NIST Chemistry Reference | Methohexitone(151-83-7) |
Safety Information
| Hazard Codes | F,T |
| Risk Statements | 11-23/24/25-39/23/24/25 |
| Safety Statements | 16-36/37-45 |
| RIDADR | 3249 |
| WGK Germany | WGK 3 |
| HazardClass | 6.1(b) |
| PackingGroup | III |
| HS Code | 2933599550 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral |
| Toxicity | An ultra-short-acting i.v. anesthetic. Because its use causes respiratory depression, apnea, and hypotension, establishment and maintenance of airways, oxygen administration, etc. are required. Various allergic responses have sometimes been reported with its use. |
