Bisphenol A Bis(2,3-dihydroxypropyl) Ether
- Product NameBisphenol A Bis(2,3-dihydroxypropyl) Ether
- CAS5581-32-8
- MFC21H28O6
- MW376.44
- EINECS226-975-4
- MOL File5581-32-8.mol
Chemical Properties
| Melting point | 91-97 °C |
| Boiling point | 612℃ |
| Density | 1.224 |
| Flash point | 324℃ |
| storage temp. | Hygroscopic, -20°C Freezer, Under inert atmosphere |
| solubility | Acetonitrile (Slightly), Methanol (Slightly) |
| pka | 13.23±0.20(Predicted) |
| color | White to Off-White |
| BRN | 2302019 |
| Stability | Hygroscopic |
| Major Application | cleaning products cosmetics food and beverages personal care |
| InChI | 1S/C21H28O6/c1-21(2,15-3-7-19(8-4-15)26-13-17(24)11-22)16-5-9-20(10-6-16)27-14-18(25)12-23/h3-10,17-18,22-25H,11-14H2,1-2H3 |
| InChIKey | NISVZEWKUNUGQQ-UHFFFAOYSA-N |
| SMILES | CC(C)(c1ccc(OCC(O)CO)cc1)c2ccc(OCC(O)CO)cc2 |
Safety Information
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| Storage Class | 11 - Combustible Solids |
