| Melting point |
-22°C |
| Boiling point |
295 °C (lit.) |
| Density |
1.107 g/mL at 25 °C (lit.) |
| vapor pressure |
3 mm Hg ( 125 °C) |
| refractive index |
n20/D 1.574(lit.) |
| Flash point |
>230 °F |
| storage temp. |
Inert atmosphere,Room Temperature |
| solubility |
sol most organic solvents; reacts with protic solvents
such as alcohols, acids, amines, water. |
| form |
clear liquid |
| color |
Colorless to Light yellow to Light orange |
| Specific Gravity |
1.128 |
| Water Solubility |
reacts |
| Sensitive |
Moisture Sensitive |
| Hydrolytic Sensitivity |
8: reacts rapidly with moisture, water, protic solvents |
| BRN |
2937445 |
| InChI |
1S/C13H13ClSi/c1-15(14,12-8-4-2-5-9-12)13-10-6-3-7-11-13/h2-11H,1H3 |
| InChIKey |
OJZNZOXALZKPEA-UHFFFAOYSA-N |
| SMILES |
C[Si](Cl)(c1ccccc1)c2ccccc2 |
| CAS DataBase Reference |
144-79-6(CAS DataBase Reference) |
| NIST Chemistry Reference |
Silane, chloromethyldiphenyl-(144-79-6) |
| EPA Substance Registry System |
Silane, chloromethyldiphenyl- (144-79-6) |
