4-Amino-3-hydroxybenzoic acid
- Product Name4-Amino-3-hydroxybenzoic acid
- CAS2374-03-0
- MFC7H7NO3
- MW153.14
- EINECS
- MOL File2374-03-0.mol
Chemical Properties
| Melting point | 211-215 °C (lit.) |
| Boiling point | 385.7±37.0 °C(Predicted) |
| Density | 1.028 |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| pka | 4.74±0.10(Predicted) |
| form | Crystalline Powder |
| color | Yellow-brown to brown |
| Water Solubility | Soluble in chloroform, and aqeous ethanol, water (Partly miscible) |
| BRN | 509859 |
| Major Application | peptide synthesis |
| InChI | InChI=1S/C7H7NO3/c8-5-2-1-4(7(10)11)3-6(5)9/h1-3,9H,8H2,(H,10,11) |
| InChIKey | NFPYJDZQOKCYIE-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=CC=C(N)C(O)=C1 |
| CAS DataBase Reference | 2374-03-0(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xn,Xi |
| Risk Statements | 36/37/38-22 |
| Safety Statements | 26-37/39 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HS Code | 29225090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |