2,3,5,6-Tetrafluorophenol
- Product Name2,3,5,6-Tetrafluorophenol
- CAS769-39-1
- MFC6H2F4O
- MW166.07
- EINECS212-209-6
- MOL File769-39-1.mol
Chemical Properties
| Melting point | 37-39 °C (lit.) |
| Boiling point | 140 °C (lit.) |
| Density | 1.4445 (estimate) |
| Flash point | 175 °F |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| pka | 5.46±0.20(Predicted) |
| form | Crystalline Low Melting Solid |
| color | White |
| Water Solubility | Partly miscible with water. |
| BRN | 1911548 |
| Stability | Stable. Incompatible with acid chlorides, acid anhydrides, oxidizing agents. |
| InChI | InChI=1S/C6H2F4O/c7-2-1-3(8)5(10)6(11)4(2)9/h1,11H |
| InChIKey | PBYIIRLNRCVTMQ-UHFFFAOYSA-N |
| SMILES | C1(O)=C(F)C(F)=CC(F)=C1F |
| CAS DataBase Reference | 769-39-1(CAS DataBase Reference) |
| NIST Chemistry Reference | 2,3,5,6-Tetrafluorophenol(769-39-1) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| RIDADR | UN3261 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 29081990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |