3,4,5-Trimethoxyphenylacetonitrile
- Product Name3,4,5-Trimethoxyphenylacetonitrile
- CAS13338-63-1
- MFC11H13NO3
- MW207.23
- EINECS236-388-5
- MOL File13338-63-1.mol
Chemical Properties
| Melting point | 77-79 °C (lit.) |
| Boiling point | 346.25°C (rough estimate) |
| Density | 1.1878 (rough estimate) |
| refractive index | 1.5100 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | soluble in Methanol |
| form | powder to crystaline |
| color | White to Light yellow |
| BRN | 2214548 |
| Exposure limits | NIOSH: IDLH 25 mg/m3 |
| InChI | InChI=1S/C11H13NO3/c1-13-9-6-8(4-5-12)7-10(14-2)11(9)15-3/h6-7H,4H2,1-3H3 |
| InChIKey | ACFJNTXCEQCDBX-UHFFFAOYSA-N |
| SMILES | C1(CC#N)=CC(OC)=C(OC)C(OC)=C1 |
| CAS DataBase Reference | 13338-63-1(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xn |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 26-36-24/25 |
| RIDADR | 3276 |
| WGK Germany | 3 |
| RTECS | AM2475000 |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29269090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral |
