| Melting point |
35-38 °C(lit.) |
| Boiling point |
142-144°C 1mm |
| Density |
1.0380 |
| refractive index |
1.6118 (estimate) |
| Flash point |
>230 °F |
| storage temp. |
Keep in dark place,Inert atmosphere,Room temperature |
| solubility |
soluble in Methanol |
| form |
powder to lump to clear liquid |
| pka |
2.17(at 25℃) |
| color |
White or colorless to Amber to Dark green |
| BRN |
2208463 |
| InChI |
InChI=1S/C13H13N/c14-13-8-6-12(7-9-13)10-11-4-2-1-3-5-11/h1-9H,10,14H2 |
| InChIKey |
WDTRNCFZFQIWLM-UHFFFAOYSA-N |
| SMILES |
C1(N)=CC=C(CC2=CC=CC=C2)C=C1 |
| CAS DataBase Reference |
1135-12-2(CAS DataBase Reference) |
