Tetraethylammonium hexafluorophosphate
- Product NameTetraethylammonium hexafluorophosphate
- CAS429-07-2
- MFC8H20F6NP
- MW275.22
- EINECS207-056-7
- MOL File429-07-2.mol
Chemical Properties
| Melting point | ≥300 °C (lit.) |
| storage temp. | Storage temp. 2-8°C |
| solubility | acetonitrile: 0.1 g/mL, clear, colorless |
| form | Crystalline |
| Appearance | White to off-white Solid |
| Water Solubility | Soluble in water, alcohol, and acetonitrile. |
| Sensitive | Hygroscopic |
| BRN | 3748868 |
| InChI | InChI=1S/C8H20N.F6P/c1-5-9(6-2,7-3)8-4;1-7(2,3,4,5)6/h5-8H2,1-4H3;/q+1;-1 |
| InChIKey | KLKUOIXSIDDDCN-UHFFFAOYSA-N |
| SMILES | [P-](F)(F)(F)(F)(F)F.[N+](CC)(CC)(CC)CC |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| RIDADR | UN2811 |
| WGK Germany | 3 |
| RTECS | BS6500000 |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29239000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
