TRIMETHYLSILYL(TRIMETHYLSILOXY)ACETATE
- Product NameTRIMETHYLSILYL(TRIMETHYLSILOXY)ACETATE
- CAS33581-77-0
- MFC8H20O3Si2
- MW220.41
- EINECS251-580-9
- MOL File33581-77-0.mol
Chemical Properties
| Boiling point | 82-83 °C15 mm Hg |
| Density | 0.903 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point | 110 °F |
| storage temp. | Inert atmosphere,Room Temperature |
| Specific Gravity | 0.918 |
| Appearance | Colorless to light yellow Liquid |
| Hydrolytic Sensitivity | 7: reacts slowly with moisture/water |
| BRN | 2045011 |
| Cosmetics Ingredients Functions | SKIN CONDITIONING |
| InChI | 1S/C8H20O3Si2/c1-12(2,3)10-7-8(9)11-13(4,5)6/h7H2,1-6H3 |
| InChIKey | MAEQOWMWOCEXKP-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)OCC(=O)O[Si](C)(C)C |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 10-36/37/38 |
| Safety Statements | 26-36 |
| RIDADR | UN 3272 3/PG 3 |
| WGK Germany | 2 |
| F | 21 |
| TSCA | No |
| HazardClass | 3.2 |
| PackingGroup | III |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Eye Irrit. 2 Flam. Liq. 3 Skin Irrit. 2 STOT SE 3 |
