| Melting point |
222-226 °C |
| Boiling point |
343.02°C (rough estimate) |
| Density |
1.0752 (rough estimate) |
| refractive index |
1.6000 (estimate) |
| storage temp. |
Sealed in dry,Room Temperature |
| pka |
4.22±0.10(Predicted) |
| form |
powder to crystal |
| color |
White to Orange to Green |
| BRN |
6314193 |
| Stability |
Stable. Incompatible with bases, oxidizing agents. Combustible. |
| InChI |
InChI=1S/C16H16O2/c1-2-3-12-4-6-13(7-5-12)14-8-10-15(11-9-14)16(17)18/h4-11H,2-3H2,1H3,(H,17,18) |
| InChIKey |
HCPBURTZSXRGBN-UHFFFAOYSA-N |
| SMILES |
C1(C2=CC=C(CCC)C=C2)=CC=C(C(O)=O)C=C1 |
| CAS DataBase Reference |
88038-94-2(CAS DataBase Reference) |
| NIST Chemistry Reference |
4-Propylbiphenyl-4'-carboxylic acid(88038-94-2) |
